C22H40N2O10+2 — CID 163133487
[1-[(2R,3S,4S,5R)-1,6-diacetyloxy-3,4-dihydroxy-5-[(2S)-3-methyl-2-(methylazaniumyl)butanoyl]oxyhexan-2-yl]oxy-3-methyl-1-oxobut-2-en-2-yl]-methylazanium (PubChem CID 163133487) has the molecular formula C22H40N2O10+2 and a molecular weight of 492.57 g/mol. Its IUPAC name is [1-[(2R,3S,4S,5R)-1,6-diacetyloxy-3,4-dihydroxy-5-[(2S)-3-methyl-2-(methylazaniumyl)butanoyl]oxyhexan-2-yl]oxy-3-methyl-1-oxobut-2-en-2-yl]-methylazanium.
| Compound Name | [1-[(2R,3S,4S,5R)-1,6-diacetyloxy-3,4-dihydroxy-5-[(2S)-3-methyl-2-(methylazaniumyl)butanoyl]oxyhexan-2-yl]oxy-3-methyl-1-oxobut-2-en-2-yl]-methylazanium |
|---|---|
| PubChem CID | 163133487 |
| Molecular Formula | C22H40N2O10+2 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | [1-[(2R,3S,4S,5R)-1,6-diacetyloxy-3,4-dihydroxy-5-[(2S)-3-methyl-2-(methylazaniumyl)butanoyl]oxyhexan-2-yl]oxy-3-methyl-1-oxobut-2-en-2-yl]-methylazanium |
| SMILES | C[NH2+]C(C(=O)O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@@H](COC(C)=O)OC(=O)[C@@H]([NH2+]C)C(C)C)=C(C)C |
| InChI | InChI=1S/C22H38N2O10/c1-11(2)17(23-7)21(29)33-15(9-31-13(5)25)19(27)20(28)16(10-32-14(6)26)34-22(30)18(24-8)12(3)4/h11,15-17,19-20,23-24,27-28H,9-10H2,1-8H3/p+2/t15-,16-,17+,19-,20-/m1/s1 |
| InChIKey | HAOVUVKKWGMXBS-HPUSYDDDSA-P |
| XLogP | -2.64 |
| TPSA | 178.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|