C22H36N2O10 — CID 163125086
[1-[1,6-diacetyloxy-3,4-dihydroxy-5-[2-(methanidylazaniumyl)-3-methylbut-2-enoyl]oxyhexan-2-yl]oxy-3-methyl-1-oxobut-2-en-2-yl]-methanidylazanium (PubChem CID 163125086) has the molecular formula C22H36N2O10 and a molecular weight of 488.53 g/mol. Its IUPAC name is [1-[1,6-diacetyloxy-3,4-dihydroxy-5-[2-(methanidylazaniumyl)-3-methylbut-2-enoyl]oxyhexan-2-yl]oxy-3-methyl-1-oxobut-2-en-2-yl]-methanidylazanium.
| Compound Name | [1-[1,6-diacetyloxy-3,4-dihydroxy-5-[2-(methanidylazaniumyl)-3-methylbut-2-enoyl]oxyhexan-2-yl]oxy-3-methyl-1-oxobut-2-en-2-yl]-methanidylazanium |
|---|---|
| PubChem CID | 163125086 |
| Molecular Formula | C22H36N2O10 |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | [1-[1,6-diacetyloxy-3,4-dihydroxy-5-[2-(methanidylazaniumyl)-3-methylbut-2-enoyl]oxyhexan-2-yl]oxy-3-methyl-1-oxobut-2-en-2-yl]-methanidylazanium |
| SMILES | [CH2-][NH2+]C(C(=O)OC(COC(C)=O)C(O)C(O)C(COC(C)=O)OC(=O)C([NH2+][CH2-])=C(C)C)=C(C)C |
| InChI | InChI=1S/C22H36N2O10/c1-11(2)17(23-7)21(29)33-15(9-31-13(5)25)19(27)20(28)16(10-32-14(6)26)34-22(30)18(24-8)12(3)4/h15-16,19-20,27-28H,7-10,23-24H2,1-6H3 |
| InChIKey | CZIYBAISERXSDG-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 178.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|