C36H38N5O5+ — CID 143297262
[amino-[2-amino-5-[[(3S,7R,8S,9S)-7-benzyl-4-[(3-carboxyphenyl)methyl]-8,9-dihydroxy-5-oxo-2-phenyl-4,6-diazaspiro[2.6]nonan-6-yl]methyl]phenyl]methylidene]azanium (PubChem CID 143297262) has the molecular formula C36H38N5O5+ and a molecular weight of 620.73 g/mol. Its IUPAC name is [amino-[2-amino-5-[[(3S,7R,8S,9S)-7-benzyl-4-[(3-carboxyphenyl)methyl]-8,9-dihydroxy-5-oxo-2-phenyl-4,6-diazaspiro[2.6]nonan-6-yl]methyl]phenyl]methylidene]azanium.
| Compound Name | [amino-[2-amino-5-[[(3S,7R,8S,9S)-7-benzyl-4-[(3-carboxyphenyl)methyl]-8,9-dihydroxy-5-oxo-2-phenyl-4,6-diazaspiro[2.6]nonan-6-yl]methyl]phenyl]methylidene]azanium |
|---|---|
| PubChem CID | 143297262 |
| Molecular Formula | C36H38N5O5+ |
| Molecular Weight | 620.73 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | [amino-[2-amino-5-[[(3S,7R,8S,9S)-7-benzyl-4-[(3-carboxyphenyl)methyl]-8,9-dihydroxy-5-oxo-2-phenyl-4,6-diazaspiro[2.6]nonan-6-yl]methyl]phenyl]methylidene]azanium |
| SMILES | NC(=[NH2+])c1cc(CN2C(=O)N(Cc3cccc(C(=O)O)c3)[C@]3(CC3c3ccccc3)[C@H](O)[C@@H](O)[C@H]2Cc2ccccc2)ccc1N |
| InChI | InChI=1S/C36H37N5O5/c37-29-15-14-24(17-27(29)33(38)39)20-40-30(18-22-8-3-1-4-9-22)31(42)32(43)36(19-28(36)25-11-5-2-6-12-25)41(35(40)46)21-23-10-7-13-26(16-23)34(44)45/h1-17,28,30-32,42-43H,18-21,37H2,(H3,38,39)(H,44,45)/p+1/t28?,30-,31+,32-,36+/m1/s1 |
| InChIKey | BNMKYKQYCOALKO-QKKKPDPGSA-O |
| XLogP | 2.13 |
| TPSA | 178.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|