C27H44N3O6PS — CID 143297356
N-[(3R)-4-[4-(diethoxyphosphorylmethyl)-N-methylanilino]-3-(methylamino)butyl]-4-methoxy-N-propylbenzenesulfonamide (PubChem CID 143297356) has the molecular formula C27H44N3O6PS and a molecular weight of 569.71 g/mol. Its IUPAC name is N-[(3R)-4-[4-(diethoxyphosphorylmethyl)-N-methylanilino]-3-(methylamino)butyl]-4-methoxy-N-propylbenzenesulfonamide.
| Compound Name | N-[(3R)-4-[4-(diethoxyphosphorylmethyl)-N-methylanilino]-3-(methylamino)butyl]-4-methoxy-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 143297356 |
| Molecular Formula | C27H44N3O6PS |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | N-[(3R)-4-[4-(diethoxyphosphorylmethyl)-N-methylanilino]-3-(methylamino)butyl]-4-methoxy-N-propylbenzenesulfonamide |
| SMILES | CCCN(CC[C@H](CN(C)c1ccc(CP(=O)(OCC)OCC)cc1)NC)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H44N3O6PS/c1-7-19-30(38(32,33)27-16-14-26(34-6)15-17-27)20-18-24(28-4)21-29(5)25-12-10-23(11-13-25)22-37(31,35-8-2)36-9-3/h10-17,24,28H,7-9,18-22H2,1-6H3/t24-/m1/s1 |
| InChIKey | RGMSHILUAOKKFY-XMMPIXPASA-N |
| XLogP | 4.98 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|