C16H32N4O3 — CID 143297448
N-butan-2-yl-2-[[1-(1-hydroxybutan-2-ylamino)-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide (PubChem CID 143297448) has the molecular formula C16H32N4O3 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-butan-2-yl-2-[[1-(1-hydroxybutan-2-ylamino)-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide.
| Compound Name | N-butan-2-yl-2-[[1-(1-hydroxybutan-2-ylamino)-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 143297448 |
| Molecular Formula | C16H32N4O3 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | N-butan-2-yl-2-[[1-(1-hydroxybutan-2-ylamino)-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide |
| SMILES | CCC(C)NC(=O)C(C)(C)/N=N/C(C)(C)C(=O)NC(CC)CO |
| InChI | InChI=1S/C16H32N4O3/c1-8-11(3)17-13(22)15(4,5)19-20-16(6,7)14(23)18-12(9-2)10-21/h11-12,21H,8-10H2,1-7H3,(H,17,22)(H,18,23)/b20-19+ |
| InChIKey | AJVAGRIOTAWXEP-FMQUCBEESA-N |
| XLogP | 1.80 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|