C8H10ClF6NO2 — CID 3101689
4-chloro-2,2,3,3,4,4-hexafluoro-N-(1-hydroxybutan-2-yl)butanamide (PubChem CID 3101689) has the molecular formula C8H10ClF6NO2 and a molecular weight of 301.61 g/mol. Its IUPAC name is 4-chloro-2,2,3,3,4,4-hexafluoro-N-(1-hydroxybutan-2-yl)butanamide.
| Compound Name | 4-chloro-2,2,3,3,4,4-hexafluoro-N-(1-hydroxybutan-2-yl)butanamide |
|---|---|
| PubChem CID | 3101689 |
| Molecular Formula | C8H10ClF6NO2 |
| Molecular Weight | 301.61 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 4-chloro-2,2,3,3,4,4-hexafluoro-N-(1-hydroxybutan-2-yl)butanamide |
| SMILES | CCC(CO)NC(=O)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C8H10ClF6NO2/c1-2-4(3-17)16-5(18)6(10,11)7(12,13)8(9,14)15/h4,17H,2-3H2,1H3,(H,16,18) |
| InChIKey | ZNBRPSDGONUTHN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.61 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|