C24H22N4O — CID 143298031
N-[3-(7-but-3-enyl-4-methylpyrrolo[2,3-d]pyrimidin-5-yl)phenyl]benzamide (PubChem CID 143298031) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is N-[3-(7-but-3-enyl-4-methylpyrrolo[2,3-d]pyrimidin-5-yl)phenyl]benzamide.
| Compound Name | N-[3-(7-but-3-enyl-4-methylpyrrolo[2,3-d]pyrimidin-5-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 143298031 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-[3-(7-but-3-enyl-4-methylpyrrolo[2,3-d]pyrimidin-5-yl)phenyl]benzamide |
| SMILES | C=CCCn1cc(-c2cccc(NC(=O)c3ccccc3)c2)c2c(C)ncnc21 |
| InChI | InChI=1S/C24H22N4O/c1-3-4-13-28-15-21(22-17(2)25-16-26-23(22)28)19-11-8-12-20(14-19)27-24(29)18-9-6-5-7-10-18/h3,5-12,14-16H,1,4,13H2,2H3,(H,27,29) |
| InChIKey | IESSNYOULKEMEL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|