C23H19ClN4O — CID 58001849
N-[3-(7-but-3-enyl-4-chloropyrrolo[2,3-d]pyrimidin-5-yl)phenyl]benzamide (PubChem CID 58001849) has the molecular formula C23H19ClN4O and a molecular weight of 402.89 g/mol. Its IUPAC name is N-[3-(7-but-3-enyl-4-chloropyrrolo[2,3-d]pyrimidin-5-yl)phenyl]benzamide.
| Compound Name | N-[3-(7-but-3-enyl-4-chloropyrrolo[2,3-d]pyrimidin-5-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 58001849 |
| Molecular Formula | C23H19ClN4O |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[3-(7-but-3-enyl-4-chloropyrrolo[2,3-d]pyrimidin-5-yl)phenyl]benzamide |
| SMILES | C=CCCn1cc(-c2cccc(NC(=O)c3ccccc3)c2)c2c(Cl)ncnc21 |
| InChI | InChI=1S/C23H19ClN4O/c1-2-3-12-28-14-19(20-21(24)25-15-26-22(20)28)17-10-7-11-18(13-17)27-23(29)16-8-5-4-6-9-16/h2,4-11,13-15H,1,3,12H2,(H,27,29) |
| InChIKey | BXPJLRBIVQWDRT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|