C31H50O3 — CID 143299501
1-[2,3,8,8-tetramethyl-5-[(2,3',7',7'-tetramethylspiro[1,3-dioxane-5,2'-bicyclo[4.1.0]heptane]-2-yl)methyl]-1,3,4,5,6,7-hexahydronaphthalen-2-yl]ethanone (PubChem CID 143299501) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is 1-[2,3,8,8-tetramethyl-5-[(2,3',7',7'-tetramethylspiro[1,3-dioxane-5,2'-bicyclo[4.1.0]heptane]-2-yl)methyl]-1,3,4,5,6,7-hexahydronaphthalen-2-yl]ethanone.
| Compound Name | 1-[2,3,8,8-tetramethyl-5-[(2,3',7',7'-tetramethylspiro[1,3-dioxane-5,2'-bicyclo[4.1.0]heptane]-2-yl)methyl]-1,3,4,5,6,7-hexahydronaphthalen-2-yl]ethanone |
|---|---|
| PubChem CID | 143299501 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | 1-[2,3,8,8-tetramethyl-5-[(2,3',7',7'-tetramethylspiro[1,3-dioxane-5,2'-bicyclo[4.1.0]heptane]-2-yl)methyl]-1,3,4,5,6,7-hexahydronaphthalen-2-yl]ethanone |
| SMILES | CC(=O)C1(C)CC2=C(CC1C)C(CC1(C)OCC3(CO1)C(C)CCC1C3C1(C)C)CCC2(C)C |
| InChI | InChI=1S/C31H50O3/c1-19-10-11-24-26(28(24,6)7)31(19)17-33-30(9,34-18-31)15-22-12-13-27(4,5)25-16-29(8,21(3)32)20(2)14-23(22)25/h19-20,22,24,26H,10-18H2,1-9H3 |
| InChIKey | IUYMKOXMJPZHIG-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|