C18H21IN2O5 — CID 143304720
N'-[2-(3-hydroxyphenyl)-1-methoxyethyl]-2-iodo-4,5-dimethoxybenzohydrazide (PubChem CID 143304720) has the molecular formula C18H21IN2O5 and a molecular weight of 472.28 g/mol. Its IUPAC name is N'-[2-(3-hydroxyphenyl)-1-methoxyethyl]-2-iodo-4,5-dimethoxybenzohydrazide.
| Compound Name | N'-[2-(3-hydroxyphenyl)-1-methoxyethyl]-2-iodo-4,5-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 143304720 |
| Molecular Formula | C18H21IN2O5 |
| Molecular Weight | 472.28 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | N'-[2-(3-hydroxyphenyl)-1-methoxyethyl]-2-iodo-4,5-dimethoxybenzohydrazide |
| SMILES | COc1cc(I)c(C(=O)NNC(Cc2cccc(O)c2)OC)cc1OC |
| InChI | InChI=1S/C18H21IN2O5/c1-24-15-9-13(14(19)10-16(15)25-2)18(23)21-20-17(26-3)8-11-5-4-6-12(22)7-11/h4-7,9-10,17,20,22H,8H2,1-3H3,(H,21,23) |
| InChIKey | JIAOXMBPBIJCLV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|