C21H39NO4 — CID 143306297
2-(3-methylbutoxy)ethanamine;3-methyl-3-[(2E,4Z)-6-prop-2-ynoxyhexa-2,4-dien-3-yl]oxybutan-1-ol (PubChem CID 143306297) has the molecular formula C21H39NO4 and a molecular weight of 369.55 g/mol. Its IUPAC name is 2-(3-methylbutoxy)ethanamine;3-methyl-3-[(2E,4Z)-6-prop-2-ynoxyhexa-2,4-dien-3-yl]oxybutan-1-ol.
| Compound Name | 2-(3-methylbutoxy)ethanamine;3-methyl-3-[(2E,4Z)-6-prop-2-ynoxyhexa-2,4-dien-3-yl]oxybutan-1-ol |
|---|---|
| PubChem CID | 143306297 |
| Molecular Formula | C21H39NO4 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.29 |
| IUPAC Name | 2-(3-methylbutoxy)ethanamine;3-methyl-3-[(2E,4Z)-6-prop-2-ynoxyhexa-2,4-dien-3-yl]oxybutan-1-ol |
| SMILES | C#CCOC/C=C\C(=C/C)OC(C)(C)CCO.CC(C)CCOCCN |
| InChI | InChI=1S/C14H22O3.C7H17NO/c1-5-11-16-12-7-8-13(6-2)17-14(3,4)9-10-15;1-7(2)3-5-9-6-4-8/h1,6-8,15H,9-12H2,2-4H3;7H,3-6,8H2,1-2H3/b8-7-,13-6+; |
| InChIKey | YSTSTDSTIFWGLL-KHKVGLMXSA-N |
| XLogP | 3.28 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|