C21H33N5O4S — CID 143306986
3-[(6Z)-6-(1-aminoethylidene)-1-butyl-5-oxo-4H-1,2,4-triazin-3-yl]-4-ethoxy-N,N-diethylbenzenesulfonamide (PubChem CID 143306986) has the molecular formula C21H33N5O4S and a molecular weight of 451.59 g/mol. Its IUPAC name is 3-[(6Z)-6-(1-aminoethylidene)-1-butyl-5-oxo-4H-1,2,4-triazin-3-yl]-4-ethoxy-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-[(6Z)-6-(1-aminoethylidene)-1-butyl-5-oxo-4H-1,2,4-triazin-3-yl]-4-ethoxy-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 143306986 |
| Molecular Formula | C21H33N5O4S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 3-[(6Z)-6-(1-aminoethylidene)-1-butyl-5-oxo-4H-1,2,4-triazin-3-yl]-4-ethoxy-N,N-diethylbenzenesulfonamide |
| SMILES | CCCCN1N=C(c2cc(S(=O)(=O)N(CC)CC)ccc2OCC)NC(=O)/C1=C(\C)N |
| InChI | InChI=1S/C21H33N5O4S/c1-6-10-13-26-19(15(5)22)21(27)23-20(24-26)17-14-16(11-12-18(17)30-9-4)31(28,29)25(7-2)8-3/h11-12,14H,6-10,13,22H2,1-5H3,(H,23,24,27)/b19-15- |
| InChIKey | ZJTXZANUWAJKPS-CYVLTUHYSA-N |
| XLogP | 2.20 |
| TPSA | 117.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|