C30H51N7O4S — CID 142847603
N-[3-[(6Z)-6-(1-aminoethylidene)-1-(2-ethylnonyl)-5-oxo-4H-1,2,4-triazin-3-yl]-4-ethoxyphenyl]-4-ethylpiperazine-1-sulfonamide (PubChem CID 142847603) has the molecular formula C30H51N7O4S and a molecular weight of 605.85 g/mol. Its IUPAC name is N-[3-[(6Z)-6-(1-aminoethylidene)-1-(2-ethylnonyl)-5-oxo-4H-1,2,4-triazin-3-yl]-4-ethoxyphenyl]-4-ethylpiperazine-1-sulfonamide.
| Compound Name | N-[3-[(6Z)-6-(1-aminoethylidene)-1-(2-ethylnonyl)-5-oxo-4H-1,2,4-triazin-3-yl]-4-ethoxyphenyl]-4-ethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 142847603 |
| Molecular Formula | C30H51N7O4S |
| Molecular Weight | 605.85 g/mol |
| Exact Mass | 605.37 |
| IUPAC Name | N-[3-[(6Z)-6-(1-aminoethylidene)-1-(2-ethylnonyl)-5-oxo-4H-1,2,4-triazin-3-yl]-4-ethoxyphenyl]-4-ethylpiperazine-1-sulfonamide |
| SMILES | CCCCCCCC(CC)CN1N=C(c2cc(NS(=O)(=O)N3CCN(CC)CC3)ccc2OCC)NC(=O)/C1=C(\C)N |
| InChI | InChI=1S/C30H51N7O4S/c1-6-10-11-12-13-14-24(7-2)22-37-28(23(5)31)30(38)32-29(33-37)26-21-25(15-16-27(26)41-9-4)34-42(39,40)36-19-17-35(8-3)18-20-36/h15-16,21,24,34H,6-14,17-20,22,31H2,1-5H3,(H,32,33,38)/b28-23- |
| InChIKey | OPGGXLMOVQFXOG-NFFVHWSESA-N |
| XLogP | 4.05 |
| TPSA | 132.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.85 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|