C18H18N2O4 — CID 143309358
ethane;1-(4-nitro-1,2-dihydro-[1]benzofuro[2,3-e]indol-3-yl)ethanone (PubChem CID 143309358) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is ethane;1-(4-nitro-1,2-dihydro-[1]benzofuro[2,3-e]indol-3-yl)ethanone.
| Compound Name | ethane;1-(4-nitro-1,2-dihydro-[1]benzofuro[2,3-e]indol-3-yl)ethanone |
|---|---|
| PubChem CID | 143309358 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | ethane;1-(4-nitro-1,2-dihydro-[1]benzofuro[2,3-e]indol-3-yl)ethanone |
| SMILES | CC.CC(=O)N1CCc2c1c([N+](=O)[O-])cc1c2oc2ccccc21 |
| InChI | InChI=1S/C16H12N2O4.C2H6/c1-9(19)17-7-6-11-15(17)13(18(20)21)8-12-10-4-2-3-5-14(10)22-16(11)12;1-2/h2-5,8H,6-7H2,1H3;1-2H3 |
| InChIKey | NOTJZKLRGXPEKX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 76.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|