C13H15N3O3 — CID 143311050
2-[2-amino-4-(2-methoxy-3-pyridinyl)cyclopenten-1-yl]-2-iminoacetic acid (PubChem CID 143311050) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[2-amino-4-(2-methoxy-3-pyridinyl)cyclopenten-1-yl]-2-iminoacetic acid.
| Compound Name | 2-[2-amino-4-(2-methoxy-3-pyridinyl)cyclopenten-1-yl]-2-iminoacetic acid |
|---|---|
| PubChem CID | 143311050 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-[2-amino-4-(2-methoxy-3-pyridinyl)cyclopenten-1-yl]-2-iminoacetic acid |
| SMILES | [H]/N=C(\C(=O)O)C1=C(N)CC(c2cccnc2OC)C1 |
| InChI | InChI=1S/C13H15N3O3/c1-19-12-8(3-2-4-16-12)7-5-9(10(14)6-7)11(15)13(17)18/h2-4,7,15H,5-6,14H2,1H3,(H,17,18)/b15-11- |
| InChIKey | FHVLDBXQXDHFRD-PTNGSMBKSA-N |
| XLogP | 1.28 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|