C30H35N3O4 — CID 143312012
methyl (2S)-1-[3-[[(2S,5R)-5-ethynyl-2-methyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]pyrrolidine-2-carboxylate (PubChem CID 143312012) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is methyl (2S)-1-[3-[[(2S,5R)-5-ethynyl-2-methyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[3-[[(2S,5R)-5-ethynyl-2-methyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 143312012 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | methyl (2S)-1-[3-[[(2S,5R)-5-ethynyl-2-methyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]pyrrolidine-2-carboxylate |
| SMILES | C#C[C@@H]1CN(C(c2cccc(O)c2)c2cccc(C(=O)N3CCC[C@H]3C(=O)OC)c2)[C@@H](C)CN1CC=C |
| InChI | InChI=1S/C30H35N3O4/c1-5-15-31-19-21(3)33(20-25(31)6-2)28(23-11-8-13-26(34)18-23)22-10-7-12-24(17-22)29(35)32-16-9-14-27(32)30(36)37-4/h2,5,7-8,10-13,17-18,21,25,27-28,34H,1,9,14-16,19-20H2,3-4H3/t21-,25+,27-,28?/m0/s1 |
| InChIKey | OVYISFOIVGVVPJ-JRLCGITCSA-N |
| XLogP | 3.45 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|