C28H35N3O4 — CID 68700021
1-[3-[[(2R,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]pyrrolidine-2-carboxylic acid (PubChem CID 68700021) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is 1-[3-[[(2R,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[3-[[(2R,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 68700021 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 1-[3-[[(2R,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]pyrrolidine-2-carboxylic acid |
| SMILES | C=CCN1C[C@@H](C)N(C(c2cccc(O)c2)c2cccc(C(=O)N3CCCC3C(=O)O)c2)C[C@H]1C |
| InChI | InChI=1S/C28H35N3O4/c1-4-13-29-17-20(3)31(18-19(29)2)26(22-9-6-11-24(32)16-22)21-8-5-10-23(15-21)27(33)30-14-7-12-25(30)28(34)35/h4-6,8-11,15-16,19-20,25-26,32H,1,7,12-14,17-18H2,2-3H3,(H,34,35)/t19-,20-,25?,26?/m1/s1 |
| InChIKey | XPSUMAWHLUAWSA-WSQGFLFRSA-N |
| XLogP | 3.75 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|