C27H36N4O2 — CID 68699366
[3-[[(2R,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]phenyl]-piperazin-1-ylmethanone (PubChem CID 68699366) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is [3-[[(2R,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]phenyl]-piperazin-1-ylmethanone.
| Compound Name | [3-[[(2R,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]phenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 68699366 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | [3-[[(2R,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]phenyl]-piperazin-1-ylmethanone |
| SMILES | C=CCN1C[C@@H](C)N(C(c2cccc(O)c2)c2cccc(C(=O)N3CCNCC3)c2)C[C@H]1C |
| InChI | InChI=1S/C27H36N4O2/c1-4-13-30-18-21(3)31(19-20(30)2)26(23-8-6-10-25(32)17-23)22-7-5-9-24(16-22)27(33)29-14-11-28-12-15-29/h4-10,16-17,20-21,26,28,32H,1,11-15,18-19H2,2-3H3/t20-,21-,26?/m1/s1 |
| InChIKey | LHQSGUGOPPHXDU-UNNWOSPESA-N |
| XLogP | 3.11 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|