C34H48N4O4 — CID 58815876
ethyl 4-[[1-[3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]piperidin-4-yl]amino]butanoate (PubChem CID 58815876) has the molecular formula C34H48N4O4 and a molecular weight of 576.78 g/mol. Its IUPAC name is ethyl 4-[[1-[3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]piperidin-4-yl]amino]butanoate.
| Compound Name | ethyl 4-[[1-[3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]piperidin-4-yl]amino]butanoate |
|---|---|
| PubChem CID | 58815876 |
| Molecular Formula | C34H48N4O4 |
| Molecular Weight | 576.78 g/mol |
| Exact Mass | 576.37 |
| IUPAC Name | ethyl 4-[[1-[3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]piperidin-4-yl]amino]butanoate |
| SMILES | C=CCN1C[C@H](C)N([C@@H](c2cccc(O)c2)c2cccc(C(=O)N3CCC(NCCCC(=O)OCC)CC3)c2)C[C@H]1C |
| InChI | InChI=1S/C34H48N4O4/c1-5-18-37-23-26(4)38(24-25(37)3)33(28-11-8-13-31(39)22-28)27-10-7-12-29(21-27)34(41)36-19-15-30(16-20-36)35-17-9-14-32(40)42-6-2/h5,7-8,10-13,21-22,25-26,30,33,35,39H,1,6,9,14-20,23-24H2,2-4H3/t25-,26+,33-/m1/s1 |
| InChIKey | QCQHNUGWOGQEKE-YPMZNXIVSA-N |
| XLogP | 4.60 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.78 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|