C36H52N4O4 — CID 89085486
ethyl 7-[4-[3-[[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]piperazin-1-yl]heptanoate (PubChem CID 89085486) has the molecular formula C36H52N4O4 and a molecular weight of 604.84 g/mol. Its IUPAC name is ethyl 7-[4-[3-[[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]piperazin-1-yl]heptanoate.
| Compound Name | ethyl 7-[4-[3-[[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]piperazin-1-yl]heptanoate |
|---|---|
| PubChem CID | 89085486 |
| Molecular Formula | C36H52N4O4 |
| Molecular Weight | 604.84 g/mol |
| Exact Mass | 604.40 |
| IUPAC Name | ethyl 7-[4-[3-[[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]piperazin-1-yl]heptanoate |
| SMILES | C=CCN1C[C@H](C)N(C(c2cccc(O)c2)c2cccc(C(=O)N3CCN(CCCCCCC(=O)OCC)CC3)c2)C[C@H]1C |
| InChI | InChI=1S/C36H52N4O4/c1-5-18-39-26-29(4)40(27-28(39)3)35(31-14-12-16-33(41)25-31)30-13-11-15-32(24-30)36(43)38-22-20-37(21-23-38)19-10-8-7-9-17-34(42)44-6-2/h5,11-16,24-25,28-29,35,41H,1,6-10,17-23,26-27H2,2-4H3/t28-,29+,35?/m1/s1 |
| InChIKey | ROOBPASCSAHOGU-AUYWKQLASA-N |
| XLogP | 5.33 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.84 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|