C37H48N4O4 — CID 70904014
6-[4-[3-[[(2S,5R)-4-benzyl-2,5-dimethylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]piperazin-1-yl]hexanoic acid (PubChem CID 70904014) has the molecular formula C37H48N4O4 and a molecular weight of 612.82 g/mol. Its IUPAC name is 6-[4-[3-[[(2S,5R)-4-benzyl-2,5-dimethylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]piperazin-1-yl]hexanoic acid.
| Compound Name | 6-[4-[3-[[(2S,5R)-4-benzyl-2,5-dimethylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]piperazin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 70904014 |
| Molecular Formula | C37H48N4O4 |
| Molecular Weight | 612.82 g/mol |
| Exact Mass | 612.37 |
| IUPAC Name | 6-[4-[3-[[(2S,5R)-4-benzyl-2,5-dimethylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]benzoyl]piperazin-1-yl]hexanoic acid |
| SMILES | C[C@@H]1CN(C(c2cccc(O)c2)c2cccc(C(=O)N3CCN(CCCCCC(=O)O)CC3)c2)[C@@H](C)CN1Cc1ccccc1 |
| InChI | InChI=1S/C37H48N4O4/c1-28-26-41(29(2)25-40(28)27-30-11-5-3-6-12-30)36(32-14-10-16-34(42)24-32)31-13-9-15-33(23-31)37(45)39-21-19-38(20-22-39)18-8-4-7-17-35(43)44/h3,5-6,9-16,23-24,28-29,36,42H,4,7-8,17-22,25-27H2,1-2H3,(H,43,44)/t28-,29+,36?/m1/s1 |
| InChIKey | XCSCCWXAVOWKTH-IGOVJOMASA-N |
| XLogP | 5.48 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.82 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|