C35H44N4O3 — CID 143311847
5-[4-[3-[(4-benzyl-2-methylpiperazin-1-yl)-(3-hydroxyphenyl)methyl]benzoyl]piperazin-1-yl]pentanal (PubChem CID 143311847) has the molecular formula C35H44N4O3 and a molecular weight of 568.76 g/mol. Its IUPAC name is 5-[4-[3-[(4-benzyl-2-methylpiperazin-1-yl)-(3-hydroxyphenyl)methyl]benzoyl]piperazin-1-yl]pentanal.
| Compound Name | 5-[4-[3-[(4-benzyl-2-methylpiperazin-1-yl)-(3-hydroxyphenyl)methyl]benzoyl]piperazin-1-yl]pentanal |
|---|---|
| PubChem CID | 143311847 |
| Molecular Formula | C35H44N4O3 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.34 |
| IUPAC Name | 5-[4-[3-[(4-benzyl-2-methylpiperazin-1-yl)-(3-hydroxyphenyl)methyl]benzoyl]piperazin-1-yl]pentanal |
| SMILES | CC1CN(Cc2ccccc2)CCN1C(c1cccc(O)c1)c1cccc(C(=O)N2CCN(CCCCC=O)CC2)c1 |
| InChI | InChI=1S/C35H44N4O3/c1-28-26-37(27-29-10-4-2-5-11-29)19-22-39(28)34(31-13-9-15-33(41)25-31)30-12-8-14-32(24-30)35(42)38-20-17-36(18-21-38)16-6-3-7-23-40/h2,4-5,8-15,23-25,28,34,41H,3,6-7,16-22,26-27H2,1H3 |
| InChIKey | IWIIIKYBTHNNJV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|