C36H45FN4O2 — CID 143312006
5-[4-[1-[3-[[4-[(3-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]phenyl]ethenyl]piperazin-1-yl]pentanal (PubChem CID 143312006) has the molecular formula C36H45FN4O2 and a molecular weight of 584.78 g/mol. Its IUPAC name is 5-[4-[1-[3-[[4-[(3-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]phenyl]ethenyl]piperazin-1-yl]pentanal.
| Compound Name | 5-[4-[1-[3-[[4-[(3-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]phenyl]ethenyl]piperazin-1-yl]pentanal |
|---|---|
| PubChem CID | 143312006 |
| Molecular Formula | C36H45FN4O2 |
| Molecular Weight | 584.78 g/mol |
| Exact Mass | 584.35 |
| IUPAC Name | 5-[4-[1-[3-[[4-[(3-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]phenyl]ethenyl]piperazin-1-yl]pentanal |
| SMILES | C=C(c1cccc(C(c2cccc(O)c2)N2CCN(Cc3cccc(F)c3)CC2C)c1)N1CCN(CCCCC=O)CC1 |
| InChI | InChI=1S/C36H45FN4O2/c1-28-26-39(27-30-9-6-13-34(37)23-30)18-21-41(28)36(33-12-8-14-35(43)25-33)32-11-7-10-31(24-32)29(2)40-19-16-38(17-20-40)15-4-3-5-22-42/h6-14,22-25,28,36,43H,2-5,15-21,26-27H2,1H3 |
| InChIKey | JSKUFKAVNUQWQR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.78 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|