C38H52N4O4 — CID 143311925
3-[(4-benzyl-2-methylpiperazin-1-yl)-(3-hydroxyphenyl)methyl]benzaldehyde;7-(4-methylpiperazin-1-yl)heptanoic acid (PubChem CID 143311925) has the molecular formula C38H52N4O4 and a molecular weight of 628.86 g/mol. Its IUPAC name is 3-[(4-benzyl-2-methylpiperazin-1-yl)-(3-hydroxyphenyl)methyl]benzaldehyde;7-(4-methylpiperazin-1-yl)heptanoic acid.
| Compound Name | 3-[(4-benzyl-2-methylpiperazin-1-yl)-(3-hydroxyphenyl)methyl]benzaldehyde;7-(4-methylpiperazin-1-yl)heptanoic acid |
|---|---|
| PubChem CID | 143311925 |
| Molecular Formula | C38H52N4O4 |
| Molecular Weight | 628.86 g/mol |
| Exact Mass | 628.40 |
| IUPAC Name | 3-[(4-benzyl-2-methylpiperazin-1-yl)-(3-hydroxyphenyl)methyl]benzaldehyde;7-(4-methylpiperazin-1-yl)heptanoic acid |
| SMILES | CC1CN(Cc2ccccc2)CCN1C(c1cccc(O)c1)c1cccc(C=O)c1.CN1CCN(CCCCCCC(=O)O)CC1 |
| InChI | InChI=1S/C26H28N2O2.C12H24N2O2/c1-20-17-27(18-21-7-3-2-4-8-21)13-14-28(20)26(24-11-6-12-25(30)16-24)23-10-5-9-22(15-23)19-29;1-13-8-10-14(11-9-13)7-5-3-2-4-6-12(15)16/h2-12,15-16,19-20,26,30H,13-14,17-18H2,1H3;2-11H2,1H3,(H,15,16) |
| InChIKey | OXVYKCPEYJSLHQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.86 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|