C30H34N6O3 — CID 18671802
5-[5-[4-[(4-benzylpiperazin-1-yl)-(3-hydroxyphenyl)methyl]phenyl]tetrazol-2-yl]pentanoic acid (PubChem CID 18671802) has the molecular formula C30H34N6O3 and a molecular weight of 526.64 g/mol. Its IUPAC name is 5-[5-[4-[(4-benzylpiperazin-1-yl)-(3-hydroxyphenyl)methyl]phenyl]tetrazol-2-yl]pentanoic acid.
| Compound Name | 5-[5-[4-[(4-benzylpiperazin-1-yl)-(3-hydroxyphenyl)methyl]phenyl]tetrazol-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 18671802 |
| Molecular Formula | C30H34N6O3 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | 5-[5-[4-[(4-benzylpiperazin-1-yl)-(3-hydroxyphenyl)methyl]phenyl]tetrazol-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCn1nnc(-c2ccc(C(c3cccc(O)c3)N3CCN(Cc4ccccc4)CC3)cc2)n1 |
| InChI | InChI=1S/C30H34N6O3/c37-27-10-6-9-26(21-27)29(35-19-17-34(18-20-35)22-23-7-2-1-3-8-23)24-12-14-25(15-13-24)30-31-33-36(32-30)16-5-4-11-28(38)39/h1-3,6-10,12-15,21,29,37H,4-5,11,16-20,22H2,(H,38,39) |
| InChIKey | XHWPIBJWYJFMQQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|