C32H38N4O3 — CID 59945644
5-[5-[(R)-[(2S,5R)-4-benzyl-2,5-dimethylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]indazol-1-yl]pentanoic acid (PubChem CID 59945644) has the molecular formula C32H38N4O3 and a molecular weight of 526.68 g/mol. Its IUPAC name is 5-[5-[(R)-[(2S,5R)-4-benzyl-2,5-dimethylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]indazol-1-yl]pentanoic acid.
| Compound Name | 5-[5-[(R)-[(2S,5R)-4-benzyl-2,5-dimethylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]indazol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 59945644 |
| Molecular Formula | C32H38N4O3 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | 5-[5-[(R)-[(2S,5R)-4-benzyl-2,5-dimethylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]indazol-1-yl]pentanoic acid |
| SMILES | C[C@@H]1CN([C@@H](c2cccc(O)c2)c2ccc3c(cnn3CCCCC(=O)O)c2)[C@@H](C)CN1Cc1ccccc1 |
| InChI | InChI=1S/C32H38N4O3/c1-23-21-35(24(2)20-34(23)22-25-9-4-3-5-10-25)32(26-11-8-12-29(37)18-26)27-14-15-30-28(17-27)19-33-36(30)16-7-6-13-31(38)39/h3-5,8-12,14-15,17-19,23-24,32,37H,6-7,13,16,20-22H2,1-2H3,(H,38,39)/t23-,24+,32+/m1/s1 |
| InChIKey | NIVWHCQNXVGCHU-FXZPAHAQSA-N |
| XLogP | 5.68 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|