C29H40N6O3 — CID 23559059
5-[5-[4-[(R)-[(2S,5R)-4-butyl-2,5-dimethylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]phenyl]tetrazol-1-yl]pentanoic acid (PubChem CID 23559059) has the molecular formula C29H40N6O3 and a molecular weight of 520.68 g/mol. Its IUPAC name is 5-[5-[4-[(R)-[(2S,5R)-4-butyl-2,5-dimethylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]phenyl]tetrazol-1-yl]pentanoic acid.
| Compound Name | 5-[5-[4-[(R)-[(2S,5R)-4-butyl-2,5-dimethylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]phenyl]tetrazol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 23559059 |
| Molecular Formula | C29H40N6O3 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | 5-[5-[4-[(R)-[(2S,5R)-4-butyl-2,5-dimethylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]phenyl]tetrazol-1-yl]pentanoic acid |
| SMILES | CCCCN1C[C@H](C)N(C(c2ccc(-c3nnnn3CCCCC(=O)O)cc2)c2cccc(O)c2)C[C@H]1C |
| InChI | InChI=1S/C29H40N6O3/c1-4-5-16-33-19-22(3)34(20-21(33)2)28(25-9-8-10-26(36)18-25)23-12-14-24(15-13-23)29-30-31-32-35(29)17-7-6-11-27(37)38/h8-10,12-15,18,21-22,28,36H,4-7,11,16-17,19-20H2,1-3H3,(H,37,38)/t21-,22+,28?/m1/s1 |
| InChIKey | GIKCLGIRGYOVIV-YDOMFUIGSA-N |
| XLogP | 4.58 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|