C28H41N3O2 — CID 70290065
2-[(R)-[(2S,5S)-2,5-dimethyl-4-pentylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-ethyl-N-methylbenzamide (PubChem CID 70290065) has the molecular formula C28H41N3O2 and a molecular weight of 451.66 g/mol. Its IUPAC name is 2-[(R)-[(2S,5S)-2,5-dimethyl-4-pentylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-ethyl-N-methylbenzamide.
| Compound Name | 2-[(R)-[(2S,5S)-2,5-dimethyl-4-pentylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-ethyl-N-methylbenzamide |
|---|---|
| PubChem CID | 70290065 |
| Molecular Formula | C28H41N3O2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | 2-[(R)-[(2S,5S)-2,5-dimethyl-4-pentylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-ethyl-N-methylbenzamide |
| SMILES | CCCCCN1C[C@H](C)N([C@H](c2cccc(O)c2)c2ccccc2C(=O)N(C)CC)C[C@@H]1C |
| InChI | InChI=1S/C28H41N3O2/c1-6-8-11-17-30-19-22(4)31(20-21(30)3)27(23-13-12-14-24(32)18-23)25-15-9-10-16-26(25)28(33)29(5)7-2/h9-10,12-16,18,21-22,27,32H,6-8,11,17,19-20H2,1-5H3/t21-,22-,27+/m0/s1 |
| InChIKey | KLKCLGSURRJNQF-BCQCSXDESA-N |
| XLogP | 5.16 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|