C31H37N3O2 — CID 67729072
N-benzyl-2-[(R)-[(2S)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-methylbenzamide (PubChem CID 67729072) has the molecular formula C31H37N3O2 and a molecular weight of 483.66 g/mol. Its IUPAC name is N-benzyl-2-[(R)-[(2S)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-methylbenzamide.
| Compound Name | N-benzyl-2-[(R)-[(2S)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 67729072 |
| Molecular Formula | C31H37N3O2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | N-benzyl-2-[(R)-[(2S)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-methylbenzamide |
| SMILES | C=CCN1C[C@H](C)N([C@H](c2cccc(O)c2)c2ccccc2C(=O)N(C)Cc2ccccc2)CC1C |
| InChI | InChI=1S/C31H37N3O2/c1-5-18-33-20-24(3)34(21-23(33)2)30(26-14-11-15-27(35)19-26)28-16-9-10-17-29(28)31(36)32(4)22-25-12-7-6-8-13-25/h5-17,19,23-24,30,35H,1,18,20-22H2,2-4H3/t23?,24-,30+/m0/s1 |
| InChIKey | HACIYWHHXDQIIO-LERNEWSCSA-N |
| XLogP | 5.33 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|