C30H35N3O3 — CID 67748811
benzyl N-[3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(2-hydroxyphenyl)methyl]phenyl]carbamate (PubChem CID 67748811) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is benzyl N-[3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(2-hydroxyphenyl)methyl]phenyl]carbamate.
| Compound Name | benzyl N-[3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(2-hydroxyphenyl)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 67748811 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | benzyl N-[3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(2-hydroxyphenyl)methyl]phenyl]carbamate |
| SMILES | C=CCN1C[C@H](C)N([C@H](c2cccc(NC(=O)OCc3ccccc3)c2)c2ccccc2O)C[C@H]1C |
| InChI | InChI=1S/C30H35N3O3/c1-4-17-32-19-23(3)33(20-22(32)2)29(27-15-8-9-16-28(27)34)25-13-10-14-26(18-25)31-30(35)36-21-24-11-6-5-7-12-24/h4-16,18,22-23,29,34H,1,17,19-21H2,2-3H3,(H,31,35)/t22-,23+,29-/m1/s1 |
| InChIKey | GTVJGPBAGODXFJ-RLPNJSHFSA-N |
| XLogP | 5.81 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|