C25H30N6O3 — CID 23559090
4-[5-[4-[(R)-(3-hydroxyphenyl)-(4-prop-2-enylpiperazin-1-yl)methyl]phenyl]tetrazol-1-yl]butanoic acid (PubChem CID 23559090) has the molecular formula C25H30N6O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is 4-[5-[4-[(R)-(3-hydroxyphenyl)-(4-prop-2-enylpiperazin-1-yl)methyl]phenyl]tetrazol-1-yl]butanoic acid.
| Compound Name | 4-[5-[4-[(R)-(3-hydroxyphenyl)-(4-prop-2-enylpiperazin-1-yl)methyl]phenyl]tetrazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 23559090 |
| Molecular Formula | C25H30N6O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 4-[5-[4-[(R)-(3-hydroxyphenyl)-(4-prop-2-enylpiperazin-1-yl)methyl]phenyl]tetrazol-1-yl]butanoic acid |
| SMILES | C=CCN1CCN([C@H](c2ccc(-c3nnnn3CCCC(=O)O)cc2)c2cccc(O)c2)CC1 |
| InChI | InChI=1S/C25H30N6O3/c1-2-12-29-14-16-30(17-15-29)24(21-5-3-6-22(32)18-21)19-8-10-20(11-9-19)25-26-27-28-31(25)13-4-7-23(33)34/h2-3,5-6,8-11,18,24,32H,1,4,7,12-17H2,(H,33,34)/t24-/m1/s1 |
| InChIKey | UECZHWGUAFFGRO-XMMPIXPASA-N |
| XLogP | 2.80 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|