C32H47N3O4 — CID 57155429
ethyl 5-[[4-[(R)-[(2S,5R)-4-butyl-2,5-dimethylpiperazin-1-yl]-(3-methoxyphenyl)methyl]benzoyl]amino]pentanoate (PubChem CID 57155429) has the molecular formula C32H47N3O4 and a molecular weight of 537.75 g/mol. Its IUPAC name is ethyl 5-[[4-[(R)-[(2S,5R)-4-butyl-2,5-dimethylpiperazin-1-yl]-(3-methoxyphenyl)methyl]benzoyl]amino]pentanoate.
| Compound Name | ethyl 5-[[4-[(R)-[(2S,5R)-4-butyl-2,5-dimethylpiperazin-1-yl]-(3-methoxyphenyl)methyl]benzoyl]amino]pentanoate |
|---|---|
| PubChem CID | 57155429 |
| Molecular Formula | C32H47N3O4 |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.36 |
| IUPAC Name | ethyl 5-[[4-[(R)-[(2S,5R)-4-butyl-2,5-dimethylpiperazin-1-yl]-(3-methoxyphenyl)methyl]benzoyl]amino]pentanoate |
| SMILES | CCCCN1C[C@H](C)N([C@H](c2ccc(C(=O)NCCCCC(=O)OCC)cc2)c2cccc(OC)c2)C[C@H]1C |
| InChI | InChI=1S/C32H47N3O4/c1-6-8-20-34-22-25(4)35(23-24(34)3)31(28-12-11-13-29(21-28)38-5)26-15-17-27(18-16-26)32(37)33-19-10-9-14-30(36)39-7-2/h11-13,15-18,21,24-25,31H,6-10,14,19-20,22-23H2,1-5H3,(H,33,37)/t24-,25+,31-/m1/s1 |
| InChIKey | PAJRFVJZCLFQOY-UALAUUDGSA-N |
| XLogP | 5.44 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|