C31H41N5O4 — CID 143311893
4-[[1-[3-[(3-hydroxyphenyl)-(2-methyl-4-prop-2-enylpiperazin-1-yl)methyl]benzoyl]piperidin-4-yl]amino]-N-oxobutanamide (PubChem CID 143311893) has the molecular formula C31H41N5O4 and a molecular weight of 547.70 g/mol. Its IUPAC name is 4-[[1-[3-[(3-hydroxyphenyl)-(2-methyl-4-prop-2-enylpiperazin-1-yl)methyl]benzoyl]piperidin-4-yl]amino]-N-oxobutanamide.
| Compound Name | 4-[[1-[3-[(3-hydroxyphenyl)-(2-methyl-4-prop-2-enylpiperazin-1-yl)methyl]benzoyl]piperidin-4-yl]amino]-N-oxobutanamide |
|---|---|
| PubChem CID | 143311893 |
| Molecular Formula | C31H41N5O4 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.32 |
| IUPAC Name | 4-[[1-[3-[(3-hydroxyphenyl)-(2-methyl-4-prop-2-enylpiperazin-1-yl)methyl]benzoyl]piperidin-4-yl]amino]-N-oxobutanamide |
| SMILES | C=CCN1CCN(C(c2cccc(O)c2)c2cccc(C(=O)N3CCC(NCCCC(=O)N=O)CC3)c2)C(C)C1 |
| InChI | InChI=1S/C31H41N5O4/c1-3-15-34-18-19-36(23(2)22-34)30(25-8-5-10-28(37)21-25)24-7-4-9-26(20-24)31(39)35-16-12-27(13-17-35)32-14-6-11-29(38)33-40/h3-5,7-10,20-21,23,27,30,32,37H,1,6,11-19,22H2,2H3 |
| InChIKey | ZYUBMWJVILMCQG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|