C22H32O — CID 143317310
[(3E,5E,7Z)-6-(cyclopropylmethoxy)-2-methylnona-3,5,7-trien-2-yl]benzene;ethane (PubChem CID 143317310) has the molecular formula C22H32O and a molecular weight of 312.50 g/mol. Its IUPAC name is [(3E,5E,7Z)-6-(cyclopropylmethoxy)-2-methylnona-3,5,7-trien-2-yl]benzene;ethane.
| Compound Name | [(3E,5E,7Z)-6-(cyclopropylmethoxy)-2-methylnona-3,5,7-trien-2-yl]benzene;ethane |
|---|---|
| PubChem CID | 143317310 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | [(3E,5E,7Z)-6-(cyclopropylmethoxy)-2-methylnona-3,5,7-trien-2-yl]benzene;ethane |
| SMILES | C/C=C\C(=C/C=C/C(C)(C)c1ccccc1)OCC1CC1.CC |
| InChI | InChI=1S/C20H26O.C2H6/c1-4-9-19(21-16-17-13-14-17)12-8-15-20(2,3)18-10-6-5-7-11-18;1-2/h4-12,15,17H,13-14,16H2,1-3H3;1-2H3/b9-4-,15-8+,19-12+; |
| InChIKey | LLVKIJUGQHFDMS-UAPJOFNRSA-N |
| XLogP | 6.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|