About acetonitrile;[(2R)-3-(4-chlorophenoxy)-2-fluoropropoxy]thallium
acetonitrile;[(2R)-3-(4-chlorophenoxy)-2-fluoropropoxy]thallium (PubChem CID 143317359) has the molecular formula C11H12ClFNO2Tl
and a molecular weight of 449.06 g/mol. Its IUPAC name is acetonitrile;[(2R)-3-(4-chlorophenoxy)-2-fluoropropoxy]thallium.
Molecular Properties
| Compound Name | acetonitrile;[(2R)-3-(4-chlorophenoxy)-2-fluoropropoxy]thallium |
| PubChem CID | 143317359 |
| Molecular Formula | C11H12ClFNO2Tl |
| Molecular Weight | 449.06 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | acetonitrile;[(2R)-3-(4-chlorophenoxy)-2-fluoropropoxy]thallium |
| SMILES | CC#N.F[C@@H](CO[Tl])COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H9ClFO2.C2H3N.Tl/c10-7-1-3-9(4-2-7)13-6-8(11)5-12;1-2-3;/h1-4,8H,5-6H2;1H3;/q-1;;+1/t8-;;/m0../s1 |
| InChIKey | AYLHBRQHBBTJMR-JZGIKJSDSA-N |
| XLogP | 2.69 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.06 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetonitrile;[(2R)-3-(4-chlorophenoxy)-2-fluoropropoxy]thallium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;[(2R)-3-(4-chlorophenoxy)-2-fluoropropoxy]thallium?
The IUPAC name of acetonitrile;[(2R)-3-(4-chlorophenoxy)-2-fluoropropoxy]thallium (CID 143317359) is acetonitrile;[(2R)-3-(4-chlorophenoxy)-2-fluoropropoxy]thallium.
What is the SMILES notation for acetonitrile;[(2R)-3-(4-chlorophenoxy)-2-fluoropropoxy]thallium?
The canonical SMILES for acetonitrile;[(2R)-3-(4-chlorophenoxy)-2-fluoropropoxy]thallium is CC#N.F[C@@H](CO[Tl])COc1ccc(Cl)cc1.
What is the InChIKey of acetonitrile;[(2R)-3-(4-chlorophenoxy)-2-fluoropropoxy]thallium?
The InChIKey is AYLHBRQHBBTJMR-JZGIKJSDSA-N. The full InChI is InChI=1S/C9H9ClFO2.C2H3N.Tl/c10-7-1-3-9(4-2-7)13-6-8(11)5-12;1-2-3;/h1-4,8H,5-6H2;1H3;/q-1;;+1/t8-;;/m0../s1.
What are the key properties of acetonitrile;[(2R)-3-(4-chlorophenoxy)-2-fluoropropoxy]thallium?
acetonitrile;[(2R)-3-(4-chlorophenoxy)-2-fluoropropoxy]thallium has a molecular weight of 449.06 g/mol, XLogP of 2.69, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;[(2R)-3-(4-chlorophenoxy)-2-fluoropropoxy]thallium is sourced from PubChem (CID 143317359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).