C11H11F2NO — CID 84781478
2-[4-(2,2-difluoroethoxy)phenyl]propanenitrile (PubChem CID 84781478) has the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. Its IUPAC name is 2-[4-(2,2-difluoroethoxy)phenyl]propanenitrile.
| Compound Name | 2-[4-(2,2-difluoroethoxy)phenyl]propanenitrile |
|---|---|
| PubChem CID | 84781478 |
| Molecular Formula | C11H11F2NO |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-[4-(2,2-difluoroethoxy)phenyl]propanenitrile |
| SMILES | CC(C#N)c1ccc(OCC(F)F)cc1 |
| InChI | InChI=1S/C11H11F2NO/c1-8(6-14)9-2-4-10(5-3-9)15-7-11(12)13/h2-5,8,11H,7H2,1H3 |
| InChIKey | MSRMFBOBFDFLLH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |