C24H31NO — CID 143317570
3-(9H-fluoren-9-yl)-N-propylpropanamide;2-methylbut-1-ene (PubChem CID 143317570) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is 3-(9H-fluoren-9-yl)-N-propylpropanamide;2-methylbut-1-ene.
| Compound Name | 3-(9H-fluoren-9-yl)-N-propylpropanamide;2-methylbut-1-ene |
|---|---|
| PubChem CID | 143317570 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 3-(9H-fluoren-9-yl)-N-propylpropanamide;2-methylbut-1-ene |
| SMILES | C=C(C)CC.CCCNC(=O)CCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H21NO.C5H10/c1-2-13-20-19(21)12-11-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18;1-4-5(2)3/h3-10,18H,2,11-13H2,1H3,(H,20,21);2,4H2,1,3H3 |
| InChIKey | HWQSQQVHMSPKHE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|