C15H11FO3 — CID 143318510
4-(5-fluoro-2-methyl-1-benzofuran-7-yl)benzene-1,3-diol (PubChem CID 143318510) has the molecular formula C15H11FO3 and a molecular weight of 258.25 g/mol. Its IUPAC name is 4-(5-fluoro-2-methyl-1-benzofuran-7-yl)benzene-1,3-diol.
| Compound Name | 4-(5-fluoro-2-methyl-1-benzofuran-7-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 143318510 |
| Molecular Formula | C15H11FO3 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 4-(5-fluoro-2-methyl-1-benzofuran-7-yl)benzene-1,3-diol |
| SMILES | Cc1cc2cc(F)cc(-c3ccc(O)cc3O)c2o1 |
| InChI | InChI=1S/C15H11FO3/c1-8-4-9-5-10(16)6-13(15(9)19-8)12-3-2-11(17)7-14(12)18/h2-7,17-18H,1H3 |
| InChIKey | OZORTRABLKUFSX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |