C10H8NO2SY- — CID 159824116
4-(2-methyl-5H-1,3-thiazol-5-id-4-yl)benzene-1,3-diol;yttrium (PubChem CID 159824116) has the molecular formula C10H8NO2SY- and a molecular weight of 295.15 g/mol. Its IUPAC name is 4-(2-methyl-5H-1,3-thiazol-5-id-4-yl)benzene-1,3-diol;yttrium.
| Compound Name | 4-(2-methyl-5H-1,3-thiazol-5-id-4-yl)benzene-1,3-diol;yttrium |
|---|---|
| PubChem CID | 159824116 |
| Molecular Formula | C10H8NO2SY- |
| Molecular Weight | 295.15 g/mol |
| Exact Mass | 294.93 |
| IUPAC Name | 4-(2-methyl-5H-1,3-thiazol-5-id-4-yl)benzene-1,3-diol;yttrium |
| SMILES | Cc1nc(-c2ccc(O)cc2O)[c-]s1.[Y] |
| InChI | InChI=1S/C10H8NO2S.Y/c1-6-11-9(5-14-6)8-3-2-7(12)4-10(8)13;/h2-4,12-13H,1H3;/q-1; |
| InChIKey | UVICKIYEPVSXEP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.15 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|