C11H14NO7P — CID 143320766
6,6-dimethyl-3-methylperoxy-3-oxo-2,4,8-trioxa-5-aza-3λ5-phosphabicyclo[7.2.2]trideca-1(11),9,12-trien-7-one (PubChem CID 143320766) has the molecular formula C11H14NO7P and a molecular weight of 303.21 g/mol. Its IUPAC name is 6,6-dimethyl-3-methylperoxy-3-oxo-2,4,8-trioxa-5-aza-3λ5-phosphabicyclo[7.2.2]trideca-1(11),9,12-trien-7-one.
| Compound Name | 6,6-dimethyl-3-methylperoxy-3-oxo-2,4,8-trioxa-5-aza-3λ5-phosphabicyclo[7.2.2]trideca-1(11),9,12-trien-7-one |
|---|---|
| PubChem CID | 143320766 |
| Molecular Formula | C11H14NO7P |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 6,6-dimethyl-3-methylperoxy-3-oxo-2,4,8-trioxa-5-aza-3λ5-phosphabicyclo[7.2.2]trideca-1(11),9,12-trien-7-one |
| SMILES | COOP1(=O)ONC(C)(C)C(=O)Oc2ccc(cc2)O1 |
| InChI | InChI=1S/C11H14NO7P/c1-11(2)10(13)16-8-4-6-9(7-5-8)17-20(14,18-12-11)19-15-3/h4-7,12H,1-3H3 |
| InChIKey | JGOVEOXUXZGVSG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|