C10H12BrNO4 — CID 143320891
dimethyl (2E,4E)-4-bromo-6-methyliminohepta-2,4-dienedioate (PubChem CID 143320891) has the molecular formula C10H12BrNO4 and a molecular weight of 290.11 g/mol. Its IUPAC name is dimethyl (2E,4E)-4-bromo-6-methyliminohepta-2,4-dienedioate.
| Compound Name | dimethyl (2E,4E)-4-bromo-6-methyliminohepta-2,4-dienedioate |
|---|---|
| PubChem CID | 143320891 |
| Molecular Formula | C10H12BrNO4 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | dimethyl (2E,4E)-4-bromo-6-methyliminohepta-2,4-dienedioate |
| SMILES | C/N=C(/C=C(Br)\C=C\C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C10H12BrNO4/c1-12-8(10(14)16-3)6-7(11)4-5-9(13)15-2/h4-6H,1-3H3/b5-4+,7-6+,12-8- |
| InChIKey | NXFZRLKJQONIPK-SRCWKJHESA-N |
| XLogP | 1.24 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|