C23H33NO2 — CID 143322472
1-[3-[(3E,5E)-6-(4-methoxycyclohepta-1,3,6-trien-1-yl)hepta-1,3,5-trien-3-yl]oxypropyl]piperidine (PubChem CID 143322472) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is 1-[3-[(3E,5E)-6-(4-methoxycyclohepta-1,3,6-trien-1-yl)hepta-1,3,5-trien-3-yl]oxypropyl]piperidine.
| Compound Name | 1-[3-[(3E,5E)-6-(4-methoxycyclohepta-1,3,6-trien-1-yl)hepta-1,3,5-trien-3-yl]oxypropyl]piperidine |
|---|---|
| PubChem CID | 143322472 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 1-[3-[(3E,5E)-6-(4-methoxycyclohepta-1,3,6-trien-1-yl)hepta-1,3,5-trien-3-yl]oxypropyl]piperidine |
| SMILES | C=C/C(=C\C=C(/C)C1=CC=C(OC)CC=C1)OCCCN1CCCCC1 |
| InChI | InChI=1S/C23H33NO2/c1-4-22(26-19-9-18-24-16-6-5-7-17-24)14-12-20(2)21-10-8-11-23(25-3)15-13-21/h4,8,10,12-15H,1,5-7,9,11,16-19H2,2-3H3/b20-12+,22-14+ |
| InChIKey | MORNPXUWKZTTQX-DWHBXHIASA-N |
| XLogP | 5.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|