C26H32N6O6 — CID 143324331
ethyl 2-[4-[6-(ethylcarbamoylamino)purin-9-yl]-2-methyl-2-(2-phenylethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate (PubChem CID 143324331) has the molecular formula C26H32N6O6 and a molecular weight of 524.58 g/mol. Its IUPAC name is ethyl 2-[4-[6-(ethylcarbamoylamino)purin-9-yl]-2-methyl-2-(2-phenylethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate.
| Compound Name | ethyl 2-[4-[6-(ethylcarbamoylamino)purin-9-yl]-2-methyl-2-(2-phenylethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate |
|---|---|
| PubChem CID | 143324331 |
| Molecular Formula | C26H32N6O6 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | ethyl 2-[4-[6-(ethylcarbamoylamino)purin-9-yl]-2-methyl-2-(2-phenylethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(CC(=O)OCC)C2OC(C)(CCc3ccccc3)OC21 |
| InChI | InChI=1S/C26H32N6O6/c1-4-27-25(34)31-22-19-23(29-14-28-22)32(15-30-19)24-21-20(17(36-24)13-18(33)35-5-2)37-26(3,38-21)12-11-16-9-7-6-8-10-16/h6-10,14-15,17,20-21,24H,4-5,11-13H2,1-3H3,(H2,27,28,29,31,34) |
| InChIKey | XBJKCECWPAKJOF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |