C11H17F3N2 — CID 143325756
ethane;2,2,2-trifluoro-1-(4-methylphenyl)ethane-1,1-diamine (PubChem CID 143325756) has the molecular formula C11H17F3N2 and a molecular weight of 234.27 g/mol. Its IUPAC name is ethane;2,2,2-trifluoro-1-(4-methylphenyl)ethane-1,1-diamine.
| Compound Name | ethane;2,2,2-trifluoro-1-(4-methylphenyl)ethane-1,1-diamine |
|---|---|
| PubChem CID | 143325756 |
| Molecular Formula | C11H17F3N2 |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | ethane;2,2,2-trifluoro-1-(4-methylphenyl)ethane-1,1-diamine |
| SMILES | CC.Cc1ccc(C(N)(N)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H11F3N2.C2H6/c1-6-2-4-7(5-3-6)8(13,14)9(10,11)12;1-2/h2-5H,13-14H2,1H3;1-2H3 |
| InChIKey | PQJKWYCMEGFKHY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|