C16H14F3I — CID 144855908
1-methyl-4-[2,2,2-trifluoro-1-iodo-1-(4-methylphenyl)ethyl]benzene (PubChem CID 144855908) has the molecular formula C16H14F3I and a molecular weight of 390.19 g/mol. Its IUPAC name is 1-methyl-4-[2,2,2-trifluoro-1-iodo-1-(4-methylphenyl)ethyl]benzene.
| Compound Name | 1-methyl-4-[2,2,2-trifluoro-1-iodo-1-(4-methylphenyl)ethyl]benzene |
|---|---|
| PubChem CID | 144855908 |
| Molecular Formula | C16H14F3I |
| Molecular Weight | 390.19 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 1-methyl-4-[2,2,2-trifluoro-1-iodo-1-(4-methylphenyl)ethyl]benzene |
| SMILES | Cc1ccc(C(I)(c2ccc(C)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F3I/c1-11-3-7-13(8-4-11)15(20,16(17,18)19)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | DQIAKHCWPNMGEE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.19 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|