C22H22FN3O2S — CID 143326823
2-amino-N-[3-(4-fluorophenyl)-3-(3-methylsulfinylphenyl)propyl]pyridine-4-carboxamide (PubChem CID 143326823) has the molecular formula C22H22FN3O2S and a molecular weight of 411.50 g/mol. Its IUPAC name is 2-amino-N-[3-(4-fluorophenyl)-3-(3-methylsulfinylphenyl)propyl]pyridine-4-carboxamide.
| Compound Name | 2-amino-N-[3-(4-fluorophenyl)-3-(3-methylsulfinylphenyl)propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 143326823 |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-amino-N-[3-(4-fluorophenyl)-3-(3-methylsulfinylphenyl)propyl]pyridine-4-carboxamide |
| SMILES | CS(=O)c1cccc(C(CCNC(=O)c2ccnc(N)c2)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H22FN3O2S/c1-29(28)19-4-2-3-16(13-19)20(15-5-7-18(23)8-6-15)10-12-26-22(27)17-9-11-25-21(24)14-17/h2-9,11,13-14,20H,10,12H2,1H3,(H2,24,25)(H,26,27) |
| InChIKey | ZLCHMRRLPIYVQP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |