C8H18N2 — CID 143328046
N-ethenyl-N,N'-dimethylmethanimidamide;propane (PubChem CID 143328046) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is N-ethenyl-N,N'-dimethylmethanimidamide;propane.
| Compound Name | N-ethenyl-N,N'-dimethylmethanimidamide;propane |
|---|---|
| PubChem CID | 143328046 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | N-ethenyl-N,N'-dimethylmethanimidamide;propane |
| SMILES | C=CN(C)/C=N/C.CCC |
| InChI | InChI=1S/C5H10N2.C3H8/c1-4-7(3)5-6-2;1-3-2/h4-5H,1H2,2-3H3;3H2,1-2H3/b6-5+; |
| InChIKey | QRSJIEVNDOURAY-IPZCTEOASA-N |
| XLogP | 2.14 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|