C7H10N2O — CID 143328534
N-[(1E,3Z)-4-(methylideneamino)buta-1,3-dienyl]acetamide (PubChem CID 143328534) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is N-[(1E,3Z)-4-(methylideneamino)buta-1,3-dienyl]acetamide.
| Compound Name | N-[(1E,3Z)-4-(methylideneamino)buta-1,3-dienyl]acetamide |
|---|---|
| PubChem CID | 143328534 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | N-[(1E,3Z)-4-(methylideneamino)buta-1,3-dienyl]acetamide |
| SMILES | C=N/C=C\C=C\NC(C)=O |
| InChI | InChI=1S/C7H10N2O/c1-7(10)9-6-4-3-5-8-2/h3-6H,2H2,1H3,(H,9,10)/b5-3-,6-4+ |
| InChIKey | HGBMZFXVCZQTKM-CIIODKQPSA-N |
| XLogP | 0.85 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|