C8H13N3O3S — CID 167180070
(2E,4Z)-2-methyl-5-(methylideneamino)-N'-methylsulfonylpenta-2,4-dienehydrazide (PubChem CID 167180070) has the molecular formula C8H13N3O3S and a molecular weight of 231.28 g/mol. Its IUPAC name is (2E,4Z)-2-methyl-5-(methylideneamino)-N'-methylsulfonylpenta-2,4-dienehydrazide.
| Compound Name | (2E,4Z)-2-methyl-5-(methylideneamino)-N'-methylsulfonylpenta-2,4-dienehydrazide |
|---|---|
| PubChem CID | 167180070 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | (2E,4Z)-2-methyl-5-(methylideneamino)-N'-methylsulfonylpenta-2,4-dienehydrazide |
| SMILES | C=N/C=C\C=C(/C)C(=O)NNS(C)(=O)=O |
| InChI | InChI=1S/C8H13N3O3S/c1-7(5-4-6-9-2)8(12)10-11-15(3,13)14/h4-6,11H,2H2,1,3H3,(H,10,12)/b6-4-,7-5+ |
| InChIKey | OXQAFVJYUHRSFD-XGXWUAJZSA-N |
| XLogP | -0.27 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|