C15H32O2S — CID 143329344
ethane;(Z)-3-ethyl-4,4-dimethyl-2-methylsulfonylpent-2-ene;prop-1-ene (PubChem CID 143329344) has the molecular formula C15H32O2S and a molecular weight of 276.49 g/mol. Its IUPAC name is ethane;(Z)-3-ethyl-4,4-dimethyl-2-methylsulfonylpent-2-ene;prop-1-ene.
| Compound Name | ethane;(Z)-3-ethyl-4,4-dimethyl-2-methylsulfonylpent-2-ene;prop-1-ene |
|---|---|
| PubChem CID | 143329344 |
| Molecular Formula | C15H32O2S |
| Molecular Weight | 276.49 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | ethane;(Z)-3-ethyl-4,4-dimethyl-2-methylsulfonylpent-2-ene;prop-1-ene |
| SMILES | C=CC.CC.CC/C(=C(\C)S(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C10H20O2S.C3H6.C2H6/c1-7-9(10(3,4)5)8(2)13(6,11)12;1-3-2;1-2/h7H2,1-6H3;3H,1H2,2H3;1-2H3/b9-8-;; |
| InChIKey | GQQDIRLKBOMZDO-ULDSSAIZSA-N |
| XLogP | 4.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|